C14H13FN2O2 — CID 133314156
5-fluoro-N-[1-(5-methylfuran-2-yl)ethyl]-1,3-benzoxazol-2-amine (PubChem CID 133314156) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 5-fluoro-N-[1-(5-methylfuran-2-yl)ethyl]-1,3-benzoxazol-2-amine.
| Compound Name | 5-fluoro-N-[1-(5-methylfuran-2-yl)ethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 133314156 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-fluoro-N-[1-(5-methylfuran-2-yl)ethyl]-1,3-benzoxazol-2-amine |
| SMILES | Cc1ccc(C(C)Nc2nc3cc(F)ccc3o2)o1 |
| InChI | InChI=1S/C14H13FN2O2/c1-8-3-5-12(18-8)9(2)16-14-17-11-7-10(15)4-6-13(11)19-14/h3-7,9H,1-2H3,(H,16,17) |
| InChIKey | QPUDXRBFLWMFGL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 51.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |