C24H18N6O3S — CID 24582838
[4-[(E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-2-cyanoethenyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 24582838) has the molecular formula C24H18N6O3S and a molecular weight of 470.51 g/mol. Its IUPAC name is [4-[(E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-2-cyanoethenyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-2-cyanoethenyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24582838 |
| Molecular Formula | C24H18N6O3S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | [4-[(E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-2-cyanoethenyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(/C=C(\C#N)c2nc(N)nc(Nc3ccccc3)n2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C24H18N6O3S/c1-32-19-13-15(9-10-18(19)33-22(31)20-8-5-11-34-20)12-16(14-25)21-28-23(26)30-24(29-21)27-17-6-3-2-4-7-17/h2-13H,1H3,(H3,26,27,28,29,30)/b16-12+ |
| InChIKey | HBBVWNNQRUMYBF-FOWTUZBSSA-N |
| XLogP | 4.55 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|