C23H16ClNO3 — CID 126370803
(E)-2-(1,3-benzodioxol-5-yl)-3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 126370803) has the molecular formula C23H16ClNO3 and a molecular weight of 389.84 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxol-5-yl)-3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzodioxol-5-yl)-3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126370803 |
| Molecular Formula | C23H16ClNO3 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (E)-2-(1,3-benzodioxol-5-yl)-3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(OCc2ccccc2Cl)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H16ClNO3/c24-21-4-2-1-3-18(21)14-26-20-8-5-16(6-9-20)11-19(13-25)17-7-10-22-23(12-17)28-15-27-22/h1-12H,14-15H2/b19-11- |
| InChIKey | SQOSUBFGJJTTOU-ODLFYWEKSA-N |
| XLogP | 5.71 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|