C16H9Br2NO2 — CID 127029468
(Z)-2-(1,3-benzodioxol-5-yl)-3-(3,5-dibromophenyl)prop-2-enenitrile (PubChem CID 127029468) has the molecular formula C16H9Br2NO2 and a molecular weight of 407.06 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxol-5-yl)-3-(3,5-dibromophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(3,5-dibromophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 127029468 |
| Molecular Formula | C16H9Br2NO2 |
| Molecular Weight | 407.06 g/mol |
| Exact Mass | 404.90 |
| IUPAC Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(3,5-dibromophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Br)cc(Br)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H9Br2NO2/c17-13-4-10(5-14(18)7-13)3-12(8-19)11-1-2-15-16(6-11)21-9-20-15/h1-7H,9H2/b12-3+ |
| InChIKey | ZTRZYRYQWNHXEJ-KGVSQERTSA-N |
| XLogP | 5.00 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|