C14H8INO3 — CID 1299327
(Z)-2-(1,3-benzodioxol-5-yl)-3-(5-iodofuran-2-yl)prop-2-enenitrile (PubChem CID 1299327) has the molecular formula C14H8INO3 and a molecular weight of 365.13 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxol-5-yl)-3-(5-iodofuran-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(5-iodofuran-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1299327 |
| Molecular Formula | C14H8INO3 |
| Molecular Weight | 365.13 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(5-iodofuran-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(I)o1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H8INO3/c15-14-4-2-11(19-14)5-10(7-16)9-1-3-12-13(6-9)18-8-17-12/h1-6H,8H2/b10-5+ |
| InChIKey | RYTSUTLWBHOIRX-BJMVGYQFSA-N |
| XLogP | 3.68 |
| TPSA | 55.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|