C31H39NO7 — CID 69129585
8-[4-[2-cyano-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyphenoxy]octyl 2-methylprop-2-enoate (PubChem CID 69129585) has the molecular formula C31H39NO7 and a molecular weight of 537.65 g/mol. Its IUPAC name is 8-[4-[2-cyano-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyphenoxy]octyl 2-methylprop-2-enoate.
| Compound Name | 8-[4-[2-cyano-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyphenoxy]octyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 69129585 |
| Molecular Formula | C31H39NO7 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 8-[4-[2-cyano-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyphenoxy]octyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCOc1ccc(C=C(C#N)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C31H39NO7/c1-22(2)31(33)39-16-12-10-8-7-9-11-15-38-26-14-13-23(18-27(26)34-3)17-25(21-32)24-19-28(35-4)30(37-6)29(20-24)36-5/h13-14,17-20H,1,7-12,15-16H2,2-6H3 |
| InChIKey | JMTXUGGKZMSXOH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|