C28H35NO6 — CID 59839096
4-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenoxy]butyl 2,2-dimethylbutanoate (PubChem CID 59839096) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is 4-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenoxy]butyl 2,2-dimethylbutanoate.
| Compound Name | 4-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenoxy]butyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59839096 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 4-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenoxy]butyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCCOc1ccc(/C=C(\C#N)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H35NO6/c1-7-28(2,3)27(30)35-15-9-8-14-34-24-12-10-20(17-25(24)32-5)16-22(19-29)21-11-13-23(31-4)26(18-21)33-6/h10-13,16-18H,7-9,14-15H2,1-6H3/b22-16+ |
| InChIKey | RYJHSHJVWDVNCL-CJLVFECKSA-N |
| XLogP | 5.91 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|