C44H27ClN4O9 — CID 159473482
2-[[(E)-3-[5-(4-carboxyphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid;2-chloro-5-[5-[(Z)-2-cyano-2-(3H-indol-2-yl)ethenyl]furan-2-yl]benzoic acid (PubChem CID 159473482) has the molecular formula C44H27ClN4O9 and a molecular weight of 791.17 g/mol. Its IUPAC name is 2-[[(E)-3-[5-(4-carboxyphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid;2-chloro-5-[5-[(Z)-2-cyano-2-(3H-indol-2-yl)ethenyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[[(E)-3-[5-(4-carboxyphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid;2-chloro-5-[5-[(Z)-2-cyano-2-(3H-indol-2-yl)ethenyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 159473482 |
| Molecular Formula | C44H27ClN4O9 |
| Molecular Weight | 791.17 g/mol |
| Exact Mass | 790.15 |
| IUPAC Name | 2-[[(E)-3-[5-(4-carboxyphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid;2-chloro-5-[5-[(Z)-2-cyano-2-(3H-indol-2-yl)ethenyl]furan-2-yl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(C(=O)O)cc2)o1)C(=O)Nc1ccccc1C(=O)O.N#C/C(=C\c1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1)C1=Nc2ccccc2C1 |
| InChI | InChI=1S/C22H13ClN2O3.C22H14N2O6/c23-18-7-5-14(10-17(18)22(26)27)21-8-6-16(28-21)9-15(12-24)20-11-13-3-1-2-4-19(13)25-20;23-12-15(20(25)24-18-4-2-1-3-17(18)22(28)29)11-16-9-10-19(30-16)13-5-7-14(8-6-13)21(26)27/h1-10H,11H2,(H,26,27);1-11H,(H,24,25)(H,26,27)(H,28,29)/b15-9+;15-11+ |
| InChIKey | LWBWVCHYSYLWMC-CHYQXHRUSA-N |
| XLogP | 9.42 |
| TPSA | 227.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.17 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|