C20H11BrN2OS — CID 4313225
2-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-(4-bromophenyl)prop-2-enenitrile (PubChem CID 4313225) has the molecular formula C20H11BrN2OS and a molecular weight of 407.29 g/mol. Its IUPAC name is 2-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-(4-bromophenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-(4-bromophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4313225 |
| Molecular Formula | C20H11BrN2OS |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 2-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-(4-bromophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Br)cc1)c1nc(-c2cc3ccccc3o2)cs1 |
| InChI | InChI=1S/C20H11BrN2OS/c21-16-7-5-13(6-8-16)9-15(11-22)20-23-17(12-25-20)19-10-14-3-1-2-4-18(14)24-19/h1-10,12H |
| InChIKey | YMGXLYBEEIUMEI-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|