C25H24N2S — CID 3120946
2-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-3-(2-methylphenyl)prop-2-enenitrile (PubChem CID 3120946) has the molecular formula C25H24N2S and a molecular weight of 384.55 g/mol. Its IUPAC name is 2-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-3-(2-methylphenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-3-(2-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3120946 |
| Molecular Formula | C25H24N2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-3-(2-methylphenyl)prop-2-enenitrile |
| SMILES | Cc1ccccc1C=C(C#N)c1nc(-c2ccc(C3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C25H24N2S/c1-18-7-5-6-10-22(18)15-23(16-26)25-27-24(17-28-25)21-13-11-20(12-14-21)19-8-3-2-4-9-19/h5-7,10-15,17,19H,2-4,8-9H2,1H3 |
| InChIKey | ONBPFFMBSWIOCI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|