C19H15N3O4S2 — CID 118733952
4-[(4-oxochromen-3-yl)methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118733952) has the molecular formula C19H15N3O4S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-[(4-oxochromen-3-yl)methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[(4-oxochromen-3-yl)methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118733952 |
| Molecular Formula | C19H15N3O4S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 4-[(4-oxochromen-3-yl)methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=c1c(CNc2ccc(S(=O)(=O)Nc3nccs3)cc2)coc2ccccc12 |
| InChI | InChI=1S/C19H15N3O4S2/c23-18-13(12-26-17-4-2-1-3-16(17)18)11-21-14-5-7-15(8-6-14)28(24,25)22-19-20-9-10-27-19/h1-10,12,21H,11H2,(H,20,22) |
| InChIKey | KJNSFCMMVQTDMB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |