C22H19NO7 — CID 174558299
(4E,6E)-2-amino-7-(1,3-benzodioxol-5-yl)-6-(1,3-benzodioxol-5-ylmethyl)-3-oxohepta-4,6-dienoic acid (PubChem CID 174558299) has the molecular formula C22H19NO7 and a molecular weight of 409.39 g/mol. Its IUPAC name is (4E,6E)-2-amino-7-(1,3-benzodioxol-5-yl)-6-(1,3-benzodioxol-5-ylmethyl)-3-oxohepta-4,6-dienoic acid.
| Compound Name | (4E,6E)-2-amino-7-(1,3-benzodioxol-5-yl)-6-(1,3-benzodioxol-5-ylmethyl)-3-oxohepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 174558299 |
| Molecular Formula | C22H19NO7 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (4E,6E)-2-amino-7-(1,3-benzodioxol-5-yl)-6-(1,3-benzodioxol-5-ylmethyl)-3-oxohepta-4,6-dienoic acid |
| SMILES | NC(C(=O)O)C(=O)/C=C/C(=C/c1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H19NO7/c23-21(22(25)26)16(24)4-1-13(7-14-2-5-17-19(9-14)29-11-27-17)8-15-3-6-18-20(10-15)30-12-28-18/h1-7,9-10,21H,8,11-12,23H2,(H,25,26)/b4-1+,13-7- |
| InChIKey | GBPQYPUYVAXMGG-LJFOGHRTSA-N |
| XLogP | 2.31 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|