C21H18O6 — CID 11035923
methyl (2Z)-3-(1,3-benzodioxol-5-ylmethyl)-2-(1,3-benzodioxol-5-ylmethylidene)but-3-enoate (PubChem CID 11035923) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is methyl (2Z)-3-(1,3-benzodioxol-5-ylmethyl)-2-(1,3-benzodioxol-5-ylmethylidene)but-3-enoate.
| Compound Name | methyl (2Z)-3-(1,3-benzodioxol-5-ylmethyl)-2-(1,3-benzodioxol-5-ylmethylidene)but-3-enoate |
|---|---|
| PubChem CID | 11035923 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | methyl (2Z)-3-(1,3-benzodioxol-5-ylmethyl)-2-(1,3-benzodioxol-5-ylmethylidene)but-3-enoate |
| SMILES | C=C(Cc1ccc2c(c1)OCO2)/C(=C/c1ccc2c(c1)OCO2)C(=O)OC |
| InChI | InChI=1S/C21H18O6/c1-13(7-14-3-5-17-19(9-14)26-11-24-17)16(21(22)23-2)8-15-4-6-18-20(10-15)27-12-25-18/h3-6,8-10H,1,7,11-12H2,2H3/b16-8- |
| InChIKey | UFPXOVCLQDLOSS-PXNMLYILSA-N |
| XLogP | 3.50 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|