C17H20N2O6 — CID 6999415
(2S)-2-[[2-acetamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-3-methylbutanoic acid (PubChem CID 6999415) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is (2S)-2-[[2-acetamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-acetamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 6999415 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2S)-2-[[2-acetamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(=O)NC(=Cc1ccc2c(c1)OCO2)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C17H20N2O6/c1-9(2)15(17(22)23)19-16(21)12(18-10(3)20)6-11-4-5-13-14(7-11)25-8-24-13/h4-7,9,15H,8H2,1-3H3,(H,18,20)(H,19,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | RLNFSOJVXCHOJQ-HNNXBMFYSA-N |
| XLogP | 1.12 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|