C14H11FN2O4 — CID 18629106
2-[6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]acetamide (PubChem CID 18629106) has the molecular formula C14H11FN2O4 and a molecular weight of 290.25 g/mol. Its IUPAC name is 2-[6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]acetamide.
| Compound Name | 2-[6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 18629106 |
| Molecular Formula | C14H11FN2O4 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-[6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]acetamide |
| SMILES | NC(=O)Cc1ccc(Oc2ccc3c(c2)OCO3)nc1F |
| InChI | InChI=1S/C14H11FN2O4/c15-14-8(5-12(16)18)1-4-13(17-14)21-9-2-3-10-11(6-9)20-7-19-10/h1-4,6H,5,7H2,(H2,16,18) |
| InChIKey | YKGLRZJFLHEADU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|