C13H11ClN2O3 — CID 62297582
[6-(1,3-benzodioxol-5-yloxy)-3-chloro-2-pyridinyl]methanamine (PubChem CID 62297582) has the molecular formula C13H11ClN2O3 and a molecular weight of 278.69 g/mol. Its IUPAC name is [6-(1,3-benzodioxol-5-yloxy)-3-chloro-2-pyridinyl]methanamine.
| Compound Name | [6-(1,3-benzodioxol-5-yloxy)-3-chloro-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 62297582 |
| Molecular Formula | C13H11ClN2O3 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | [6-(1,3-benzodioxol-5-yloxy)-3-chloro-2-pyridinyl]methanamine |
| SMILES | NCc1nc(Oc2ccc3c(c2)OCO3)ccc1Cl |
| InChI | InChI=1S/C13H11ClN2O3/c14-9-2-4-13(16-10(9)6-15)19-8-1-3-11-12(5-8)18-7-17-11/h1-5H,6-7,15H2 |
| InChIKey | CTLICADXSTVKBQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |