C13H7ClN2O3S — CID 103319966
4-(1,3-benzodioxol-5-yloxy)-2-chlorothieno[2,3-d]pyrimidine (PubChem CID 103319966) has the molecular formula C13H7ClN2O3S and a molecular weight of 306.73 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yloxy)-2-chlorothieno[2,3-d]pyrimidine.
| Compound Name | 4-(1,3-benzodioxol-5-yloxy)-2-chlorothieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103319966 |
| Molecular Formula | C13H7ClN2O3S |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yloxy)-2-chlorothieno[2,3-d]pyrimidine |
| SMILES | Clc1nc(Oc2ccc3c(c2)OCO3)c2ccsc2n1 |
| InChI | InChI=1S/C13H7ClN2O3S/c14-13-15-11(8-3-4-20-12(8)16-13)19-7-1-2-9-10(5-7)18-6-17-9/h1-5H,6H2 |
| InChIKey | WKLBQICSLQUNNR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |