C12H12ClN3O — CID 80863637
6-(4-chlorophenoxy)-N,2-dimethylpyrimidin-4-amine (PubChem CID 80863637) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-N,2-dimethylpyrimidin-4-amine.
| Compound Name | 6-(4-chlorophenoxy)-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80863637 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 6-(4-chlorophenoxy)-N,2-dimethylpyrimidin-4-amine |
| SMILES | CNc1cc(Oc2ccc(Cl)cc2)nc(C)n1 |
| InChI | InChI=1S/C12H12ClN3O/c1-8-15-11(14-2)7-12(16-8)17-10-5-3-9(13)4-6-10/h3-7H,1-2H3,(H,14,15,16) |
| InChIKey | URRMKFUUVIZNAJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |