C11H9Cl3N4OS — CID 80918206
[2-methylsulfanyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-yl]hydrazine (PubChem CID 80918206) has the molecular formula C11H9Cl3N4OS and a molecular weight of 351.65 g/mol. Its IUPAC name is [2-methylsulfanyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-methylsulfanyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80918206 |
| Molecular Formula | C11H9Cl3N4OS |
| Molecular Weight | 351.65 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | [2-methylsulfanyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-yl]hydrazine |
| SMILES | CSc1nc(NN)cc(Oc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H9Cl3N4OS/c1-20-11-16-9(18-15)4-10(17-11)19-8-3-6(13)5(12)2-7(8)14/h2-4H,15H2,1H3,(H,16,17,18) |
| InChIKey | SIBOYNQOJINUFR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.65 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|