C13H13Cl2N3OS — CID 80862821
6-(2,5-dichlorophenoxy)-N-ethyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80862821) has the molecular formula C13H13Cl2N3OS and a molecular weight of 330.24 g/mol. Its IUPAC name is 6-(2,5-dichlorophenoxy)-N-ethyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-(2,5-dichlorophenoxy)-N-ethyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80862821 |
| Molecular Formula | C13H13Cl2N3OS |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 6-(2,5-dichlorophenoxy)-N-ethyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CCNc1cc(Oc2cc(Cl)ccc2Cl)nc(SC)n1 |
| InChI | InChI=1S/C13H13Cl2N3OS/c1-3-16-11-7-12(18-13(17-11)20-2)19-10-6-8(14)4-5-9(10)15/h4-7H,3H2,1-2H3,(H,16,17,18) |
| InChIKey | BSJJHTVFXFTBKU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |