C14H16BrN3OS — CID 107287439
6-(5-bromo-2-methylphenoxy)-N-ethyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 107287439) has the molecular formula C14H16BrN3OS and a molecular weight of 354.27 g/mol. Its IUPAC name is 6-(5-bromo-2-methylphenoxy)-N-ethyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-(5-bromo-2-methylphenoxy)-N-ethyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107287439 |
| Molecular Formula | C14H16BrN3OS |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 6-(5-bromo-2-methylphenoxy)-N-ethyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CCNc1cc(Oc2cc(Br)ccc2C)nc(SC)n1 |
| InChI | InChI=1S/C14H16BrN3OS/c1-4-16-12-8-13(18-14(17-12)20-3)19-11-7-10(15)6-5-9(11)2/h5-8H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | XNWIHPWZWBMGAD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |