C15H18FN3OS — CID 107171734
6-(3-fluoro-4-methylphenoxy)-2-methylsulfanyl-N-propylpyrimidin-4-amine (PubChem CID 107171734) has the molecular formula C15H18FN3OS and a molecular weight of 307.39 g/mol. Its IUPAC name is 6-(3-fluoro-4-methylphenoxy)-2-methylsulfanyl-N-propylpyrimidin-4-amine.
| Compound Name | 6-(3-fluoro-4-methylphenoxy)-2-methylsulfanyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107171734 |
| Molecular Formula | C15H18FN3OS |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 6-(3-fluoro-4-methylphenoxy)-2-methylsulfanyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(Oc2ccc(C)c(F)c2)nc(SC)n1 |
| InChI | InChI=1S/C15H18FN3OS/c1-4-7-17-13-9-14(19-15(18-13)21-3)20-11-6-5-10(2)12(16)8-11/h5-6,8-9H,4,7H2,1-3H3,(H,17,18,19) |
| InChIKey | ARHPMAMRSIWBIX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |