C10H15F3N4O — CID 80969768
[2-tert-butyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]hydrazine (PubChem CID 80969768) has the molecular formula C10H15F3N4O and a molecular weight of 264.25 g/mol. Its IUPAC name is [2-tert-butyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-tert-butyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80969768 |
| Molecular Formula | C10H15F3N4O |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [2-tert-butyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]hydrazine |
| SMILES | CC(C)(C)c1nc(NN)cc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H15F3N4O/c1-9(2,3)8-15-6(17-14)4-7(16-8)18-5-10(11,12)13/h4H,5,14H2,1-3H3,(H,15,16,17) |
| InChIKey | KEMUZHHVWNPFHF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|