C10H18N4O — CID 80968739
(2-tert-butyl-6-ethoxypyrimidin-4-yl)hydrazine (PubChem CID 80968739) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is (2-tert-butyl-6-ethoxypyrimidin-4-yl)hydrazine.
| Compound Name | (2-tert-butyl-6-ethoxypyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 80968739 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (2-tert-butyl-6-ethoxypyrimidin-4-yl)hydrazine |
| SMILES | CCOc1cc(NN)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C10H18N4O/c1-5-15-8-6-7(14-11)12-9(13-8)10(2,3)4/h6H,5,11H2,1-4H3,(H,12,13,14) |
| InChIKey | LTGUSXBHHBEMLL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|