C14H22N6O — CID 116806890
[2-tert-butyl-6-(1-propylpyrazol-4-yl)oxypyrimidin-4-yl]hydrazine (PubChem CID 116806890) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is [2-tert-butyl-6-(1-propylpyrazol-4-yl)oxypyrimidin-4-yl]hydrazine.
| Compound Name | [2-tert-butyl-6-(1-propylpyrazol-4-yl)oxypyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 116806890 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [2-tert-butyl-6-(1-propylpyrazol-4-yl)oxypyrimidin-4-yl]hydrazine |
| SMILES | CCCn1cc(Oc2cc(NN)nc(C(C)(C)C)n2)cn1 |
| InChI | InChI=1S/C14H22N6O/c1-5-6-20-9-10(8-16-20)21-12-7-11(19-15)17-13(18-12)14(2,3)4/h7-9H,5-6,15H2,1-4H3,(H,17,18,19) |
| InChIKey | GIWHNEWAVMDJSO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|