C12H22N4O — CID 80968204
[2-tert-butyl-6-[(2-methylpropan-2-yl)oxy]pyrimidin-4-yl]hydrazine (PubChem CID 80968204) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is [2-tert-butyl-6-[(2-methylpropan-2-yl)oxy]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-tert-butyl-6-[(2-methylpropan-2-yl)oxy]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80968204 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | [2-tert-butyl-6-[(2-methylpropan-2-yl)oxy]pyrimidin-4-yl]hydrazine |
| SMILES | CC(C)(C)Oc1cc(NN)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H22N4O/c1-11(2,3)10-14-8(16-13)7-9(15-10)17-12(4,5)6/h7H,13H2,1-6H3,(H,14,15,16) |
| InChIKey | INXDEVWDCDHZGB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|