C8H11F3N4O2 — CID 106776344
3-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]oxypropan-1-ol (PubChem CID 106776344) has the molecular formula C8H11F3N4O2 and a molecular weight of 252.20 g/mol. Its IUPAC name is 3-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]oxypropan-1-ol.
| Compound Name | 3-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 106776344 |
| Molecular Formula | C8H11F3N4O2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]oxypropan-1-ol |
| SMILES | NNc1cc(OCCCO)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H11F3N4O2/c9-8(10,11)7-13-5(15-12)4-6(14-7)17-3-1-2-16/h4,16H,1-3,12H2,(H,13,14,15) |
| InChIKey | XKYPTTPARXRXGS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|