C9H11F3N2O2 — CID 102719752
3-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]oxy]propan-1-ol (PubChem CID 102719752) has the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. Its IUPAC name is 3-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]oxy]propan-1-ol.
| Compound Name | 3-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 102719752 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]oxy]propan-1-ol |
| SMILES | Nc1cc(C(F)(F)F)cc(OCCCO)n1 |
| InChI | InChI=1S/C9H11F3N2O2/c10-9(11,12)6-4-7(13)14-8(5-6)16-3-1-2-15/h4-5,15H,1-3H2,(H2,13,14) |
| InChIKey | XLBRDSPSFVDZRI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|