C11H16F3N3O2 — CID 102719240
2-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]-(2-methoxyethyl)amino]ethanol (PubChem CID 102719240) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]-(2-methoxyethyl)amino]ethanol.
| Compound Name | 2-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]-(2-methoxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 102719240 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]-(2-methoxyethyl)amino]ethanol |
| SMILES | COCCN(CCO)c1cc(C(F)(F)F)cc(N)n1 |
| InChI | InChI=1S/C11H16F3N3O2/c1-19-5-3-17(2-4-18)10-7-8(11(12,13)14)6-9(15)16-10/h6-7,18H,2-5H2,1H3,(H2,15,16) |
| InChIKey | DCHATHUMCSLJRT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |