C11H20N4O2 — CID 80794923
4-N,4-N-bis(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine (PubChem CID 80794923) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 4-N,4-N-bis(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-bis(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80794923 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4-N,4-N-bis(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine |
| SMILES | COCCN(CCOC)c1cc(N)nc(C)n1 |
| InChI | InChI=1S/C11H20N4O2/c1-9-13-10(12)8-11(14-9)15(4-6-16-2)5-7-17-3/h8H,4-7H2,1-3H3,(H2,12,13,14) |
| InChIKey | HQFTZBWAMWUPLR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |