C10H18N4 — CID 80753579
4-N-butyl-4-N,2-dimethylpyrimidine-4,6-diamine (PubChem CID 80753579) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-N-butyl-4-N,2-dimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-butyl-4-N,2-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80753579 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4-N-butyl-4-N,2-dimethylpyrimidine-4,6-diamine |
| SMILES | CCCCN(C)c1cc(N)nc(C)n1 |
| InChI | InChI=1S/C10H18N4/c1-4-5-6-14(3)10-7-9(11)12-8(2)13-10/h7H,4-6H2,1-3H3,(H2,11,12,13) |
| InChIKey | QLNXQNMBLKHZMO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |