C11H17F3N4O2 — CID 114565799
2-[2-methoxyethyl-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethanol (PubChem CID 114565799) has the molecular formula C11H17F3N4O2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 2-[2-methoxyethyl-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[2-methoxyethyl-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 114565799 |
| Molecular Formula | C11H17F3N4O2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-[2-methoxyethyl-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethanol |
| SMILES | CNc1nc(N(CCO)CCOC)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H17F3N4O2/c1-15-10-16-8(11(12,13)14)7-9(17-10)18(3-5-19)4-6-20-2/h7,19H,3-6H2,1-2H3,(H,15,16,17) |
| InChIKey | ITUJFIIFFMJHBI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |