C12H18F3N3O — CID 102719208
2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]-methylamino]propan-1-ol (PubChem CID 102719208) has the molecular formula C12H18F3N3O and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]-methylamino]propan-1-ol.
| Compound Name | 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 102719208 |
| Molecular Formula | C12H18F3N3O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]-methylamino]propan-1-ol |
| SMILES | CCNc1cc(C(F)(F)F)cc(N(C)C(C)CO)n1 |
| InChI | InChI=1S/C12H18F3N3O/c1-4-16-10-5-9(12(13,14)15)6-11(17-10)18(3)8(2)7-19/h5-6,8,19H,4,7H2,1-3H3,(H,16,17) |
| InChIKey | ZWYSGBIVCJQHLM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |