C12H16F3N5O — CID 106771112
2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-1-pyrrolidin-1-ylethanone (PubChem CID 106771112) has the molecular formula C12H16F3N5O and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 106771112 |
| Molecular Formula | C12H16F3N5O |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-1-pyrrolidin-1-ylethanone |
| SMILES | CN(CC(=O)N1CCCC1)c1cc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H16F3N5O/c1-19(7-10(21)20-4-2-3-5-20)9-6-8(16)17-11(18-9)12(13,14)15/h6H,2-5,7H2,1H3,(H2,16,17,18) |
| InChIKey | YDCFRYSHVVMLEM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |