C12H17F3N4O — CID 106772544
4-N-[2-(cyclopropylmethoxy)ethyl]-4-N-methyl-2-(trifluoromethyl)pyrimidine-4,6-diamine (PubChem CID 106772544) has the molecular formula C12H17F3N4O and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-N-[2-(cyclopropylmethoxy)ethyl]-4-N-methyl-2-(trifluoromethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(cyclopropylmethoxy)ethyl]-4-N-methyl-2-(trifluoromethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106772544 |
| Molecular Formula | C12H17F3N4O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-N-[2-(cyclopropylmethoxy)ethyl]-4-N-methyl-2-(trifluoromethyl)pyrimidine-4,6-diamine |
| SMILES | CN(CCOCC1CC1)c1cc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N4O/c1-19(4-5-20-7-8-2-3-8)10-6-9(16)17-11(18-10)12(13,14)15/h6,8H,2-5,7H2,1H3,(H2,16,17,18) |
| InChIKey | RSEAZFCLUICLSR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|