C10H12ClF3N4O — CID 106917431
3-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-N-methylpropanamide (PubChem CID 106917431) has the molecular formula C10H12ClF3N4O and a molecular weight of 296.68 g/mol. Its IUPAC name is 3-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-N-methylpropanamide.
| Compound Name | 3-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106917431 |
| Molecular Formula | C10H12ClF3N4O |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C)c1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H12ClF3N4O/c1-15-8(19)3-4-18(2)7-5-6(11)16-9(17-7)10(12,13)14/h5H,3-4H2,1-2H3,(H,15,19) |
| InChIKey | JFQPRQSQBHJQIC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |