C12H17F3N6 — CID 106775569
3-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-(2-methylpropyl)amino]propanenitrile (PubChem CID 106775569) has the molecular formula C12H17F3N6 and a molecular weight of 302.30 g/mol. Its IUPAC name is 3-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-(2-methylpropyl)amino]propanenitrile.
| Compound Name | 3-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-(2-methylpropyl)amino]propanenitrile |
|---|---|
| PubChem CID | 106775569 |
| Molecular Formula | C12H17F3N6 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]-(2-methylpropyl)amino]propanenitrile |
| SMILES | CC(C)CN(CCC#N)c1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N6/c1-8(2)7-21(5-3-4-16)10-6-9(20-17)18-11(19-10)12(13,14)15/h6,8H,3,5,7,17H2,1-2H3,(H,18,19,20) |
| InChIKey | KJIMIRBJKDSZKJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|