C12H17Cl2N5 — CID 102761879
3-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-(2-methylpropyl)amino]propanenitrile (PubChem CID 102761879) has the molecular formula C12H17Cl2N5 and a molecular weight of 302.21 g/mol. Its IUPAC name is 3-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-(2-methylpropyl)amino]propanenitrile.
| Compound Name | 3-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-(2-methylpropyl)amino]propanenitrile |
|---|---|
| PubChem CID | 102761879 |
| Molecular Formula | C12H17Cl2N5 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-(2-methylpropyl)amino]propanenitrile |
| SMILES | CC(C)CN(CCC#N)c1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N5/c1-8(2)7-19(5-3-4-15)12-10(14)6-9(13)11(17-12)18-16/h6,8H,3,5,7,16H2,1-2H3,(H,17,18) |
| InChIKey | FOPRWLNQMGBBCG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|