C13H22Cl2N4 — CID 102761856
N-butan-2-yl-N-butyl-3,5-dichloro-6-hydrazinylpyridin-2-amine (PubChem CID 102761856) has the molecular formula C13H22Cl2N4 and a molecular weight of 305.25 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-3,5-dichloro-6-hydrazinylpyridin-2-amine.
| Compound Name | N-butan-2-yl-N-butyl-3,5-dichloro-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 102761856 |
| Molecular Formula | C13H22Cl2N4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-butan-2-yl-N-butyl-3,5-dichloro-6-hydrazinylpyridin-2-amine |
| SMILES | CCCCN(c1nc(NN)c(Cl)cc1Cl)C(C)CC |
| InChI | InChI=1S/C13H22Cl2N4/c1-4-6-7-19(9(3)5-2)13-11(15)8-10(14)12(17-13)18-16/h8-9H,4-7,16H2,1-3H3,(H,17,18) |
| InChIKey | LXHAYPHTQSSYSE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|