C12H17Cl3N2O — CID 102750784
N-butan-2-yl-3,5,6-trichloro-N-(2-methoxyethyl)pyridin-2-amine (PubChem CID 102750784) has the molecular formula C12H17Cl3N2O and a molecular weight of 311.64 g/mol. Its IUPAC name is N-butan-2-yl-3,5,6-trichloro-N-(2-methoxyethyl)pyridin-2-amine.
| Compound Name | N-butan-2-yl-3,5,6-trichloro-N-(2-methoxyethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102750784 |
| Molecular Formula | C12H17Cl3N2O |
| Molecular Weight | 311.64 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-butan-2-yl-3,5,6-trichloro-N-(2-methoxyethyl)pyridin-2-amine |
| SMILES | CCC(C)N(CCOC)c1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl3N2O/c1-4-8(2)17(5-6-18-3)12-10(14)7-9(13)11(15)16-12/h7-8H,4-6H2,1-3H3 |
| InChIKey | FIFBJICBFHZGAP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|