C11H18Cl2N4O — CID 102762264
1-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-ethylamino]-2-methylpropan-2-ol (PubChem CID 102762264) has the molecular formula C11H18Cl2N4O and a molecular weight of 293.20 g/mol. Its IUPAC name is 1-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 102762264 |
| Molecular Formula | C11H18Cl2N4O |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCN(CC(C)(C)O)c1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H18Cl2N4O/c1-4-17(6-11(2,3)18)10-8(13)5-7(12)9(15-10)16-14/h5,18H,4,6,14H2,1-3H3,(H,15,16) |
| InChIKey | TYWLRFKWBOCMJX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|