C7H10Cl2N4 — CID 102762384
3,5-dichloro-6-hydrazinyl-N,N-dimethylpyridin-2-amine (PubChem CID 102762384) has the molecular formula C7H10Cl2N4 and a molecular weight of 221.09 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N,N-dimethylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 102762384 |
| Molecular Formula | C7H10Cl2N4 |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H10Cl2N4/c1-13(2)7-5(9)3-4(8)6(11-7)12-10/h3H,10H2,1-2H3,(H,11,12) |
| InChIKey | UMHCJFRKUKJUIE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|