C13H24N4O2S — CID 80813692
4-N-[2-(2-methoxyethoxy)ethyl]-2-methylsulfanyl-6-N-propylpyrimidine-4,6-diamine (PubChem CID 80813692) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 4-N-[2-(2-methoxyethoxy)ethyl]-2-methylsulfanyl-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(2-methoxyethoxy)ethyl]-2-methylsulfanyl-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80813692 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-N-[2-(2-methoxyethoxy)ethyl]-2-methylsulfanyl-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(NCCOCCOC)nc(SC)n1 |
| InChI | InChI=1S/C13H24N4O2S/c1-4-5-14-11-10-12(17-13(16-11)20-3)15-6-7-19-9-8-18-2/h10H,4-9H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | QPYJYBWGKAYPNM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|