C10H12N4S — CID 80647285
6-N-[2-(1,3-thiazol-4-yl)ethyl]pyridine-2,6-diamine (PubChem CID 80647285) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 6-N-[2-(1,3-thiazol-4-yl)ethyl]pyridine-2,6-diamine.
| Compound Name | 6-N-[2-(1,3-thiazol-4-yl)ethyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80647285 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 6-N-[2-(1,3-thiazol-4-yl)ethyl]pyridine-2,6-diamine |
| SMILES | Nc1cccc(NCCc2cscn2)n1 |
| InChI | InChI=1S/C10H12N4S/c11-9-2-1-3-10(14-9)12-5-4-8-6-15-7-13-8/h1-3,6-7H,4-5H2,(H3,11,12,14) |
| InChIKey | QPSGWVXQFFUASE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |