About 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine
5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine (PubChem CID 107874695) has the molecular formula C14H19N3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine |
| PubChem CID | 107874695 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine |
| SMILES | CC(C)(C)c1ccc(NCCc2cscn2)nc1 |
| InChI | InChI=1S/C14H19N3S/c1-14(2,3)11-4-5-13(16-8-11)15-7-6-12-9-18-10-17-12/h4-5,8-10H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | RALFZFTURKYGDL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine?
The IUPAC name of 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine (CID 107874695) is 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine.
What is the SMILES notation for 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine?
The canonical SMILES for 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine is CC(C)(C)c1ccc(NCCc2cscn2)nc1.
What is the InChIKey of 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine?
The InChIKey is RALFZFTURKYGDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3S/c1-14(2,3)11-4-5-13(16-8-11)15-7-6-12-9-18-10-17-12/h4-5,8-10H,6-7H2,1-3H3,(H,15,16).
What are the key properties of 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine?
5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine has a molecular weight of 261.39 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine is sourced from PubChem (CID 107874695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).