C14H19N3S — CID 107874695
5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine (PubChem CID 107874695) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine.
| Compound Name | 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 107874695 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine |
| SMILES | CC(C)(C)c1ccc(NCCc2cscn2)nc1 |
| InChI | InChI=1S/C14H19N3S/c1-14(2,3)11-4-5-13(16-8-11)15-7-6-12-9-18-10-17-12/h4-5,8-10H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | RALFZFTURKYGDL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |