C17H24N8S2 — CID 167857097
2-N-tert-butyl-4-N,6-N-bis[2-(1,3-thiazol-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 167857097) has the molecular formula C17H24N8S2 and a molecular weight of 404.57 g/mol. Its IUPAC name is 2-N-tert-butyl-4-N,6-N-bis[2-(1,3-thiazol-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-tert-butyl-4-N,6-N-bis[2-(1,3-thiazol-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 167857097 |
| Molecular Formula | C17H24N8S2 |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-N-tert-butyl-4-N,6-N-bis[2-(1,3-thiazol-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)(C)Nc1nc(NCCc2cscn2)nc(NCCc2cscn2)n1 |
| InChI | InChI=1S/C17H24N8S2/c1-17(2,3)25-16-23-14(18-6-4-12-8-26-10-20-12)22-15(24-16)19-7-5-13-9-27-11-21-13/h8-11H,4-7H2,1-3H3,(H3,18,19,22,23,24,25) |
| InChIKey | RMPZXAHNOQNHHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |