C11H14N4OS — CID 112637712
4-ethoxy-N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-2-amine (PubChem CID 112637712) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 4-ethoxy-N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 112637712 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-ethoxy-N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-2-amine |
| SMILES | CCOc1ccnc(NCCc2cscn2)n1 |
| InChI | InChI=1S/C11H14N4OS/c1-2-16-10-4-6-13-11(15-10)12-5-3-9-7-17-8-14-9/h4,6-8H,2-3,5H2,1H3,(H,12,13,15) |
| InChIKey | MRLXBVGWPKEZAR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |