C12H14N4O — CID 112636546
4-ethoxy-N-(pyridin-2-ylmethyl)pyrimidin-2-amine (PubChem CID 112636546) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-ethoxy-N-(pyridin-2-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-ethoxy-N-(pyridin-2-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112636546 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-ethoxy-N-(pyridin-2-ylmethyl)pyrimidin-2-amine |
| SMILES | CCOc1ccnc(NCc2ccccn2)n1 |
| InChI | InChI=1S/C12H14N4O/c1-2-17-11-6-8-14-12(16-11)15-9-10-5-3-4-7-13-10/h3-8H,2,9H2,1H3,(H,14,15,16) |
| InChIKey | JRNSQEYURQPBDY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |