C14H19N5 — CID 112883503
4-N-butan-2-yl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 112883503) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-N-butan-2-yl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-butan-2-yl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112883503 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-N-butan-2-yl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | CCC(C)Nc1ccnc(NCc2ccccn2)n1 |
| InChI | InChI=1S/C14H19N5/c1-3-11(2)18-13-7-9-16-14(19-13)17-10-12-6-4-5-8-15-12/h4-9,11H,3,10H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | HRUZYNXDZSGVNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |