C12H22N4 — CID 112883470
2-N,4-N-di(butan-2-yl)pyrimidine-2,4-diamine (PubChem CID 112883470) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-N,4-N-di(butan-2-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-di(butan-2-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112883470 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2-N,4-N-di(butan-2-yl)pyrimidine-2,4-diamine |
| SMILES | CCC(C)Nc1ccnc(NC(C)CC)n1 |
| InChI | InChI=1S/C12H22N4/c1-5-9(3)14-11-7-8-13-12(16-11)15-10(4)6-2/h7-10H,5-6H2,1-4H3,(H2,13,14,15,16) |
| InChIKey | BMBTVNWOVVRSOB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |